C18H20O5 — CID 102501166
3-[2-hydroxy-5-(2-hydroxyethyl)phenyl]-3-(4-methoxyphenyl)propanoic acid (PubChem CID 102501166) has the molecular formula C18H20O5 and a molecular weight of 316.35 g/mol. Its IUPAC name is 3-[2-hydroxy-5-(2-hydroxyethyl)phenyl]-3-(4-methoxyphenyl)propanoic acid.
| Compound Name | 3-[2-hydroxy-5-(2-hydroxyethyl)phenyl]-3-(4-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 102501166 |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 3-[2-hydroxy-5-(2-hydroxyethyl)phenyl]-3-(4-methoxyphenyl)propanoic acid |
| SMILES | COc1ccc(C(CC(=O)O)c2cc(CCO)ccc2O)cc1 |
| InChI | InChI=1S/C18H20O5/c1-23-14-5-3-13(4-6-14)15(11-18(21)22)16-10-12(8-9-19)2-7-17(16)20/h2-7,10,15,19-20H,8-9,11H2,1H3,(H,21,22) |
| InChIKey | DEARJAGTOMTMGN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |