C7H4O6 — CID 102501611
4-oxopyran-2,5-dicarboxylic acid (PubChem CID 102501611) has the molecular formula C7H4O6 and a molecular weight of 184.10 g/mol. Its IUPAC name is 4-oxopyran-2,5-dicarboxylic acid.
| Compound Name | 4-oxopyran-2,5-dicarboxylic acid |
|---|---|
| PubChem CID | 102501611 |
| Molecular Formula | C7H4O6 |
| Molecular Weight | 184.10 g/mol |
| Exact Mass | 184.00 |
| IUPAC Name | 4-oxopyran-2,5-dicarboxylic acid |
| SMILES | O=C(O)c1cc(=O)c(C(=O)O)co1 |
| InChI | InChI=1S/C7H4O6/c8-4-1-5(7(11)12)13-2-3(4)6(9)10/h1-2H,(H,9,10)(H,11,12) |
| InChIKey | APGFKLORSCOLLP-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.10 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |