C19H16FN3 — CID 102501782
1-ethyl-4-(4-fluorophenyl)-3-methylimidazo[1,5-a]quinoxaline (PubChem CID 102501782) has the molecular formula C19H16FN3 and a molecular weight of 305.36 g/mol. Its IUPAC name is 1-ethyl-4-(4-fluorophenyl)-3-methylimidazo[1,5-a]quinoxaline.
| Compound Name | 1-ethyl-4-(4-fluorophenyl)-3-methylimidazo[1,5-a]quinoxaline |
|---|---|
| PubChem CID | 102501782 |
| Molecular Formula | C19H16FN3 |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 1-ethyl-4-(4-fluorophenyl)-3-methylimidazo[1,5-a]quinoxaline |
| SMILES | CCc1nc(C)c2c(-c3ccc(F)cc3)nc3ccccc3n12 |
| InChI | InChI=1S/C19H16FN3/c1-3-17-21-12(2)19-18(13-8-10-14(20)11-9-13)22-15-6-4-5-7-16(15)23(17)19/h4-11H,3H2,1-2H3 |
| InChIKey | QHWSIDRRGLLBFE-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |