C18H19N5O6 — CID 10250438
(2R,3R,4S,5R)-2-[6-(2,3-dihydro-1,4-benzodioxin-3-ylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 10250438) has the molecular formula C18H19N5O6 and a molecular weight of 401.38 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-(2,3-dihydro-1,4-benzodioxin-3-ylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-(2,3-dihydro-1,4-benzodioxin-3-ylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 10250438 |
| Molecular Formula | C18H19N5O6 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-(2,3-dihydro-1,4-benzodioxin-3-ylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(NC4COc5ccccc5O4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H19N5O6/c24-5-11-14(25)15(26)18(29-11)23-8-21-13-16(19-7-20-17(13)23)22-12-6-27-9-3-1-2-4-10(9)28-12/h1-4,7-8,11-12,14-15,18,24-26H,5-6H2,(H,19,20,22)/t11-,12?,14-,15-,18-/m1/s1 |
| InChIKey | MHTMWQIPHZOLKO-ULUUBLAKSA-N |
| XLogP | -0.35 |
| TPSA | 144.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |