C15H30O7Si2 — CID 102505680
dimethyl (2R,6R)-4-oxo-2,6-bis(trimethylsilyloxy)heptanedioate (PubChem CID 102505680) has the molecular formula C15H30O7Si2 and a molecular weight of 378.57 g/mol. Its IUPAC name is dimethyl (2R,6R)-4-oxo-2,6-bis(trimethylsilyloxy)heptanedioate.
| Compound Name | dimethyl (2R,6R)-4-oxo-2,6-bis(trimethylsilyloxy)heptanedioate |
|---|---|
| PubChem CID | 102505680 |
| Molecular Formula | C15H30O7Si2 |
| Molecular Weight | 378.57 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | dimethyl (2R,6R)-4-oxo-2,6-bis(trimethylsilyloxy)heptanedioate |
| SMILES | COC(=O)[C@@H](CC(=O)C[C@@H](O[Si](C)(C)C)C(=O)OC)O[Si](C)(C)C |
| InChI | InChI=1S/C15H30O7Si2/c1-19-14(17)12(21-23(3,4)5)9-11(16)10-13(15(18)20-2)22-24(6,7)8/h12-13H,9-10H2,1-8H3/t12-,13-/m1/s1 |
| InChIKey | OPIGFKAMBAZSME-CHWSQXEVSA-N |
| XLogP | 2.12 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.57 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|