C14H30O5Si2 — CID 100980667
methyl (5S,6S)-7-oxo-5,6-bis(trimethylsilyloxy)heptanoate (PubChem CID 100980667) has the molecular formula C14H30O5Si2 and a molecular weight of 334.56 g/mol. Its IUPAC name is methyl (5S,6S)-7-oxo-5,6-bis(trimethylsilyloxy)heptanoate.
| Compound Name | methyl (5S,6S)-7-oxo-5,6-bis(trimethylsilyloxy)heptanoate |
|---|---|
| PubChem CID | 100980667 |
| Molecular Formula | C14H30O5Si2 |
| Molecular Weight | 334.56 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | methyl (5S,6S)-7-oxo-5,6-bis(trimethylsilyloxy)heptanoate |
| SMILES | COC(=O)CCC[C@H](O[Si](C)(C)C)[C@@H](C=O)O[Si](C)(C)C |
| InChI | InChI=1S/C14H30O5Si2/c1-17-14(16)10-8-9-12(18-20(2,3)4)13(11-15)19-21(5,6)7/h11-13H,8-10H2,1-7H3/t12-,13+/m0/s1 |
| InChIKey | VMVJJZIARQVKLV-QWHCGFSZSA-N |
| XLogP | 2.97 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.56 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|