C17H36O5Si2 — CID 46201676
methyl (5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-7-oxo-6-trimethylsilyloxyheptanoate (PubChem CID 46201676) has the molecular formula C17H36O5Si2 and a molecular weight of 376.64 g/mol. Its IUPAC name is methyl (5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-7-oxo-6-trimethylsilyloxyheptanoate.
| Compound Name | methyl (5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-7-oxo-6-trimethylsilyloxyheptanoate |
|---|---|
| PubChem CID | 46201676 |
| Molecular Formula | C17H36O5Si2 |
| Molecular Weight | 376.64 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | methyl (5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-7-oxo-6-trimethylsilyloxyheptanoate |
| SMILES | COC(=O)CCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C=O)O[Si](C)(C)C |
| InChI | InChI=1S/C17H36O5Si2/c1-17(2,3)24(8,9)22-14(11-10-12-16(19)20-4)15(13-18)21-23(5,6)7/h13-15H,10-12H2,1-9H3/t14-,15+/m0/s1 |
| InChIKey | XQQBYYMLOQSRDE-LSDHHAIUSA-N |
| XLogP | 4.14 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.64 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|