C20H42O5Si2 — CID 100980669
methyl (5S,6S)-7-oxo-5,6-bis(triethylsilyloxy)heptanoate (PubChem CID 100980669) has the molecular formula C20H42O5Si2 and a molecular weight of 418.72 g/mol. Its IUPAC name is methyl (5S,6S)-7-oxo-5,6-bis(triethylsilyloxy)heptanoate.
| Compound Name | methyl (5S,6S)-7-oxo-5,6-bis(triethylsilyloxy)heptanoate |
|---|---|
| PubChem CID | 100980669 |
| Molecular Formula | C20H42O5Si2 |
| Molecular Weight | 418.72 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | methyl (5S,6S)-7-oxo-5,6-bis(triethylsilyloxy)heptanoate |
| SMILES | CC[Si](CC)(CC)O[C@@H](CCCC(=O)OC)[C@@H](C=O)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C20H42O5Si2/c1-8-26(9-2,10-3)24-18(15-14-16-20(22)23-7)19(17-21)25-27(11-4,12-5)13-6/h17-19H,8-16H2,1-7H3/t18-,19+/m0/s1 |
| InChIKey | LZLFRZQWPVYUPJ-RBUKOAKNSA-N |
| XLogP | 5.31 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.72 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|