C28H70O8Si7 — CID 91749906
trimethylsilyl (2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexakis(trimethylsilyloxy)heptanoate (PubChem CID 91749906) has the molecular formula C28H70O8Si7 and a molecular weight of 731.46 g/mol. Its IUPAC name is trimethylsilyl (2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexakis(trimethylsilyloxy)heptanoate.
| Compound Name | trimethylsilyl (2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexakis(trimethylsilyloxy)heptanoate |
|---|---|
| PubChem CID | 91749906 |
| Molecular Formula | C28H70O8Si7 |
| Molecular Weight | 731.46 g/mol |
| Exact Mass | 730.35 |
| IUPAC Name | trimethylsilyl (2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexakis(trimethylsilyloxy)heptanoate |
| SMILES | C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C28H70O8Si7/c1-37(2,3)30-22-23(31-38(4,5)6)24(32-39(7,8)9)25(33-40(10,11)12)26(34-41(13,14)15)27(35-42(16,17)18)28(29)36-43(19,20)21/h23-27H,22H2,1-21H3/t23-,24-,25+,26-,27-/m1/s1 |
| InChIKey | UPRYONQLEJIRBX-IURCNINISA-N |
| XLogP | 8.32 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.46 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|