C21H50O7Si5 — CID 22211711
trimethylsilyl (2S,3R,4S,5R)-6-oxo-2,3,4,5-tetrakis(trimethylsilyloxy)hexanoate (PubChem CID 22211711) has the molecular formula C21H50O7Si5 and a molecular weight of 555.05 g/mol. Its IUPAC name is trimethylsilyl (2S,3R,4S,5R)-6-oxo-2,3,4,5-tetrakis(trimethylsilyloxy)hexanoate.
| Compound Name | trimethylsilyl (2S,3R,4S,5R)-6-oxo-2,3,4,5-tetrakis(trimethylsilyloxy)hexanoate |
|---|---|
| PubChem CID | 22211711 |
| Molecular Formula | C21H50O7Si5 |
| Molecular Weight | 555.05 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | trimethylsilyl (2S,3R,4S,5R)-6-oxo-2,3,4,5-tetrakis(trimethylsilyloxy)hexanoate |
| SMILES | C[Si](C)(C)OC(=O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](C=O)O[Si](C)(C)C |
| InChI | InChI=1S/C21H50O7Si5/c1-29(2,3)24-17(16-22)18(25-30(4,5)6)19(26-31(7,8)9)20(27-32(10,11)12)21(23)28-33(13,14)15/h16-20H,1-15H3/t17-,18+,19+,20-/m0/s1 |
| InChIKey | HDGFBGPNRURMOV-NMLBUPMWSA-N |
| XLogP | 5.44 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.05 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|