C21H20N2O3 — CID 102506983
(2R)-2-benzyl-N-hydroxy-2-methyl-N'-naphthalen-1-ylpropanediamide (PubChem CID 102506983) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is (2R)-2-benzyl-N-hydroxy-2-methyl-N'-naphthalen-1-ylpropanediamide.
| Compound Name | (2R)-2-benzyl-N-hydroxy-2-methyl-N'-naphthalen-1-ylpropanediamide |
|---|---|
| PubChem CID | 102506983 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | (2R)-2-benzyl-N-hydroxy-2-methyl-N'-naphthalen-1-ylpropanediamide |
| SMILES | C[C@](Cc1ccccc1)(C(=O)NO)C(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C21H20N2O3/c1-21(20(25)23-26,14-15-8-3-2-4-9-15)19(24)22-18-13-7-11-16-10-5-6-12-17(16)18/h2-13,26H,14H2,1H3,(H,22,24)(H,23,25)/t21-/m1/s1 |
| InChIKey | NIDVHWYOCOCSER-OAQYLSRUSA-N |
| XLogP | 3.53 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|