C21H17ClF3NO — CID 163297566
2-chloro-5,5,5-trifluoro-N-naphthalen-1-yl-2-phenylpentanamide (PubChem CID 163297566) has the molecular formula C21H17ClF3NO and a molecular weight of 391.82 g/mol. Its IUPAC name is 2-chloro-5,5,5-trifluoro-N-naphthalen-1-yl-2-phenylpentanamide.
| Compound Name | 2-chloro-5,5,5-trifluoro-N-naphthalen-1-yl-2-phenylpentanamide |
|---|---|
| PubChem CID | 163297566 |
| Molecular Formula | C21H17ClF3NO |
| Molecular Weight | 391.82 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 2-chloro-5,5,5-trifluoro-N-naphthalen-1-yl-2-phenylpentanamide |
| SMILES | O=C(Nc1cccc2ccccc12)C(Cl)(CCC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C21H17ClF3NO/c22-20(13-14-21(23,24)25,16-9-2-1-3-10-16)19(27)26-18-12-6-8-15-7-4-5-11-17(15)18/h1-12H,13-14H2,(H,26,27) |
| InChIKey | VPYPVVJIRSBIDW-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.82 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|