C23H30F3N3 — CID 10250720
4-methyl-3-(4-pentyl-1-bicyclo[2.2.2]octanyl)-5-[2-(trifluoromethyl)phenyl]-1,2,4-triazole (PubChem CID 10250720) has the molecular formula C23H30F3N3 and a molecular weight of 405.51 g/mol. Its IUPAC name is 4-methyl-3-(4-pentyl-1-bicyclo[2.2.2]octanyl)-5-[2-(trifluoromethyl)phenyl]-1,2,4-triazole.
| Compound Name | 4-methyl-3-(4-pentyl-1-bicyclo[2.2.2]octanyl)-5-[2-(trifluoromethyl)phenyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 10250720 |
| Molecular Formula | C23H30F3N3 |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 4-methyl-3-(4-pentyl-1-bicyclo[2.2.2]octanyl)-5-[2-(trifluoromethyl)phenyl]-1,2,4-triazole |
| SMILES | CCCCCC12CCC(c3nnc(-c4ccccc4C(F)(F)F)n3C)(CC1)CC2 |
| InChI | InChI=1S/C23H30F3N3/c1-3-4-7-10-21-11-14-22(15-12-21,16-13-21)20-28-27-19(29(20)2)17-8-5-6-9-18(17)23(24,25)26/h5-6,8-9H,3-4,7,10-16H2,1-2H3 |
| InChIKey | VPHWCVUMWQOWOK-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|