C19H17N3O6 — CID 102508763
3-[2-(azidomethyl)-4-methoxyphenyl]-4-hydroxy-6,7-dimethoxychromen-2-one (PubChem CID 102508763) has the molecular formula C19H17N3O6 and a molecular weight of 383.36 g/mol. Its IUPAC name is 3-[2-(azidomethyl)-4-methoxyphenyl]-4-hydroxy-6,7-dimethoxychromen-2-one.
| Compound Name | 3-[2-(azidomethyl)-4-methoxyphenyl]-4-hydroxy-6,7-dimethoxychromen-2-one |
|---|---|
| PubChem CID | 102508763 |
| Molecular Formula | C19H17N3O6 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 3-[2-(azidomethyl)-4-methoxyphenyl]-4-hydroxy-6,7-dimethoxychromen-2-one |
| SMILES | COc1ccc(-c2c(O)c3cc(OC)c(OC)cc3oc2=O)c(CN=[N+]=[N-])c1 |
| InChI | InChI=1S/C19H17N3O6/c1-25-11-4-5-12(10(6-11)9-21-22-20)17-18(23)13-7-15(26-2)16(27-3)8-14(13)28-19(17)24/h4-8,23H,9H2,1-3H3 |
| InChIKey | CKQABENOZCEXMS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|