C15H22O — CID 102509450
cis-(1S,2S)-2-but-3-yn-2-yl-1-(cyclohexen-1-yl)cyclopentan-1-ol (PubChem CID 102509450) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is cis-(1S,2S)-2-but-3-yn-2-yl-1-(cyclohexen-1-yl)cyclopentan-1-ol.
| Compound Name | cis-(1S,2S)-2-but-3-yn-2-yl-1-(cyclohexen-1-yl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 102509450 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | cis-(1S,2S)-2-but-3-yn-2-yl-1-(cyclohexen-1-yl)cyclopentan-1-ol |
| SMILES | C#CC(C)[C@@H]1CCC[C@@]1(O)C1=CCCCC1 |
| InChI | InChI=1S/C15H22O/c1-3-12(2)14-10-7-11-15(14,16)13-8-5-4-6-9-13/h1,8,12,14,16H,4-7,9-11H2,2H3/t12?,14-,15+/m0/s1 |
| InChIKey | GEDHWMLRVLVGEO-JQXSQYPDSA-N |
| XLogP | 3.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|