C15H24O — CID 101031350
cis-(1R,2R)-1-(cyclohexen-1-yl)-2-prop-1-en-2-ylcyclohexan-1-ol (PubChem CID 101031350) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is cis-(1R,2R)-1-(cyclohexen-1-yl)-2-prop-1-en-2-ylcyclohexan-1-ol.
| Compound Name | cis-(1R,2R)-1-(cyclohexen-1-yl)-2-prop-1-en-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 101031350 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | cis-(1R,2R)-1-(cyclohexen-1-yl)-2-prop-1-en-2-ylcyclohexan-1-ol |
| SMILES | C=C(C)[C@H]1CCCC[C@]1(O)C1=CCCCC1 |
| InChI | InChI=1S/C15H24O/c1-12(2)14-10-6-7-11-15(14,16)13-8-4-3-5-9-13/h8,14,16H,1,3-7,9-11H2,2H3/t14-,15+/m1/s1 |
| InChIKey | RGHSNOUDLKEQTN-CABCVRRESA-N |
| XLogP | 3.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|