C11H16O2 — CID 11008531
2-[(1R,2S)-2-(cyclohexen-1-yl)-2-hydroxycyclopropyl]acetaldehyde (PubChem CID 11008531) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-[(1R,2S)-2-(cyclohexen-1-yl)-2-hydroxycyclopropyl]acetaldehyde.
| Compound Name | 2-[(1R,2S)-2-(cyclohexen-1-yl)-2-hydroxycyclopropyl]acetaldehyde |
|---|---|
| PubChem CID | 11008531 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 2-[(1R,2S)-2-(cyclohexen-1-yl)-2-hydroxycyclopropyl]acetaldehyde |
| SMILES | O=CC[C@H]1C[C@@]1(O)C1=CCCCC1 |
| InChI | InChI=1S/C11H16O2/c12-7-6-10-8-11(10,13)9-4-2-1-3-5-9/h4,7,10,13H,1-3,5-6,8H2/t10-,11+/m0/s1 |
| InChIKey | YKIIJSAFRCJJLW-WDEREUQCSA-N |
| XLogP | 1.83 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|