C19H36O2Si — CID 134931231
trans-(1S,2S)-1-(cyclopenten-1-yl)-2-[2-tri(propan-2-yl)silyloxyethyl]cyclopropan-1-ol (PubChem CID 134931231) has the molecular formula C19H36O2Si and a molecular weight of 324.58 g/mol. Its IUPAC name is trans-(1S,2S)-1-(cyclopenten-1-yl)-2-[2-tri(propan-2-yl)silyloxyethyl]cyclopropan-1-ol.
| Compound Name | trans-(1S,2S)-1-(cyclopenten-1-yl)-2-[2-tri(propan-2-yl)silyloxyethyl]cyclopropan-1-ol |
|---|---|
| PubChem CID | 134931231 |
| Molecular Formula | C19H36O2Si |
| Molecular Weight | 324.58 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | trans-(1S,2S)-1-(cyclopenten-1-yl)-2-[2-tri(propan-2-yl)silyloxyethyl]cyclopropan-1-ol |
| SMILES | CC(C)[Si](OCC[C@H]1C[C@@]1(O)C1=CCCC1)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H36O2Si/c1-14(2)22(15(3)4,16(5)6)21-12-11-18-13-19(18,20)17-9-7-8-10-17/h9,14-16,18,20H,7-8,10-13H2,1-6H3/t18-,19+/m0/s1 |
| InChIKey | WNETUBONQXMPTE-RBUKOAKNSA-N |
| XLogP | 5.43 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.58 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|