C18H32Cl2OSi — CID 102255201
[(1R)-2,2-dichloro-1-(cyclohexen-1-yl)cyclopropyl]oxy-tri(propan-2-yl)silane (PubChem CID 102255201) has the molecular formula C18H32Cl2OSi and a molecular weight of 363.45 g/mol. Its IUPAC name is [(1R)-2,2-dichloro-1-(cyclohexen-1-yl)cyclopropyl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(1R)-2,2-dichloro-1-(cyclohexen-1-yl)cyclopropyl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 102255201 |
| Molecular Formula | C18H32Cl2OSi |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | [(1R)-2,2-dichloro-1-(cyclohexen-1-yl)cyclopropyl]oxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](O[C@@]1(C2=CCCCC2)CC1(Cl)Cl)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H32Cl2OSi/c1-13(2)22(14(3)4,15(5)6)21-17(12-18(17,19)20)16-10-8-7-9-11-16/h10,13-15H,7-9,11-12H2,1-6H3/t17-/m1/s1 |
| InChIKey | QXPDDFAZFFTCMV-QGZVFWFLSA-N |
| XLogP | 7.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|