C13H26O4Si2 — CID 102509762
methyl (2Z,4Z)-3,5-bis(trimethylsilyloxy)hexa-2,4-dienoate (PubChem CID 102509762) has the molecular formula C13H26O4Si2 and a molecular weight of 302.52 g/mol. Its IUPAC name is methyl (2Z,4Z)-3,5-bis(trimethylsilyloxy)hexa-2,4-dienoate.
| Compound Name | methyl (2Z,4Z)-3,5-bis(trimethylsilyloxy)hexa-2,4-dienoate |
|---|---|
| PubChem CID | 102509762 |
| Molecular Formula | C13H26O4Si2 |
| Molecular Weight | 302.52 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | methyl (2Z,4Z)-3,5-bis(trimethylsilyloxy)hexa-2,4-dienoate |
| SMILES | COC(=O)/C=C(/C=C(/C)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C13H26O4Si2/c1-11(16-18(3,4)5)9-12(10-13(14)15-2)17-19(6,7)8/h9-10H,1-8H3/b11-9-,12-10- |
| InChIKey | NOXNGUYTZGGGSC-HWAYABPNSA-N |
| XLogP | 3.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.52 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|