C12H22O3Si — CID 10538148
methyl (2E)-4-[tert-butyl(dimethyl)silyl]oxypenta-2,4-dienoate (PubChem CID 10538148) has the molecular formula C12H22O3Si and a molecular weight of 242.39 g/mol. Its IUPAC name is methyl (2E)-4-[tert-butyl(dimethyl)silyl]oxypenta-2,4-dienoate.
| Compound Name | methyl (2E)-4-[tert-butyl(dimethyl)silyl]oxypenta-2,4-dienoate |
|---|---|
| PubChem CID | 10538148 |
| Molecular Formula | C12H22O3Si |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | methyl (2E)-4-[tert-butyl(dimethyl)silyl]oxypenta-2,4-dienoate |
| SMILES | C=C(/C=C/C(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H22O3Si/c1-10(8-9-11(13)14-5)15-16(6,7)12(2,3)4/h8-9H,1H2,2-7H3/b9-8+ |
| InChIKey | QWTAAAOWVGQXRJ-CMDGGOBGSA-N |
| XLogP | 3.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|