C21H26N6OS — CID 10251020
2-[4-[4-[[4-(2,4-dimethyl-1,3-thiazol-5-yl)pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]ethanol (PubChem CID 10251020) has the molecular formula C21H26N6OS and a molecular weight of 410.55 g/mol. Its IUPAC name is 2-[4-[4-[[4-(2,4-dimethyl-1,3-thiazol-5-yl)pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[4-[[4-(2,4-dimethyl-1,3-thiazol-5-yl)pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 10251020 |
| Molecular Formula | C21H26N6OS |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 2-[4-[4-[[4-(2,4-dimethyl-1,3-thiazol-5-yl)pyrimidin-2-yl]amino]phenyl]piperazin-1-yl]ethanol |
| SMILES | Cc1nc(C)c(-c2ccnc(Nc3ccc(N4CCN(CCO)CC4)cc3)n2)s1 |
| InChI | InChI=1S/C21H26N6OS/c1-15-20(29-16(2)23-15)19-7-8-22-21(25-19)24-17-3-5-18(6-4-17)27-11-9-26(10-12-27)13-14-28/h3-8,28H,9-14H2,1-2H3,(H,22,24,25) |
| InChIKey | LSMLQSVRCZEVOL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|