C14H16ClNO2 — CID 102510429
2-[(2R,3S)-3-(2-chlorophenyl)-2-methyloxiran-2-yl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 102510429) has the molecular formula C14H16ClNO2 and a molecular weight of 265.74 g/mol. Its IUPAC name is 2-[(2R,3S)-3-(2-chlorophenyl)-2-methyloxiran-2-yl]-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-[(2R,3S)-3-(2-chlorophenyl)-2-methyloxiran-2-yl]-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 102510429 |
| Molecular Formula | C14H16ClNO2 |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 2-[(2R,3S)-3-(2-chlorophenyl)-2-methyloxiran-2-yl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CC1(C)COC([C@]2(C)O[C@H]2c2ccccc2Cl)=N1 |
| InChI | InChI=1S/C14H16ClNO2/c1-13(2)8-17-12(16-13)14(3)11(18-14)9-6-4-5-7-10(9)15/h4-7,11H,8H2,1-3H3/t11-,14+/m0/s1 |
| InChIKey | XLHIFVYYIZDEBJ-SMDDNHRTSA-N |
| XLogP | 3.38 |
| TPSA | 34.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|