C23H22O4 — CID 102511281
ethyl 2-[3-[(2,4-dimethylphenyl)methyl]-1,4-dioxonaphthalen-2-yl]acetate (PubChem CID 102511281) has the molecular formula C23H22O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is ethyl 2-[3-[(2,4-dimethylphenyl)methyl]-1,4-dioxonaphthalen-2-yl]acetate.
| Compound Name | ethyl 2-[3-[(2,4-dimethylphenyl)methyl]-1,4-dioxonaphthalen-2-yl]acetate |
|---|---|
| PubChem CID | 102511281 |
| Molecular Formula | C23H22O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | ethyl 2-[3-[(2,4-dimethylphenyl)methyl]-1,4-dioxonaphthalen-2-yl]acetate |
| SMILES | CCOC(=O)CC1=C(Cc2ccc(C)cc2C)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H22O4/c1-4-27-21(24)13-20-19(12-16-10-9-14(2)11-15(16)3)22(25)17-7-5-6-8-18(17)23(20)26/h5-11H,4,12-13H2,1-3H3 |
| InChIKey | KZUYKVUIWDFJRK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|