C14H13F12N3O2 — CID 102512841
1,1,1,5,5,5-hexafluoro-4-[2-[2-[(1,1,1,5,5,5-hexafluoro-4-oxopentan-2-ylidene)amino]ethylamino]ethylimino]pentan-2-one (PubChem CID 102512841) has the molecular formula C14H13F12N3O2 and a molecular weight of 483.25 g/mol. Its IUPAC name is 1,1,1,5,5,5-hexafluoro-4-[2-[2-[(1,1,1,5,5,5-hexafluoro-4-oxopentan-2-ylidene)amino]ethylamino]ethylimino]pentan-2-one.
| Compound Name | 1,1,1,5,5,5-hexafluoro-4-[2-[2-[(1,1,1,5,5,5-hexafluoro-4-oxopentan-2-ylidene)amino]ethylamino]ethylimino]pentan-2-one |
|---|---|
| PubChem CID | 102512841 |
| Molecular Formula | C14H13F12N3O2 |
| Molecular Weight | 483.25 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | 1,1,1,5,5,5-hexafluoro-4-[2-[2-[(1,1,1,5,5,5-hexafluoro-4-oxopentan-2-ylidene)amino]ethylamino]ethylimino]pentan-2-one |
| SMILES | O=C(C/C(=N\CCNCC/N=C(\CC(=O)C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H13F12N3O2/c15-11(16,17)7(5-9(30)13(21,22)23)28-3-1-27-2-4-29-8(12(18,19)20)6-10(31)14(24,25)26/h27H,1-6H2/b28-7+,29-8+ |
| InChIKey | LSYKJGGQQPCGCK-JQMCJCOYSA-N |
| XLogP | 3.63 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.25 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|