C14H19F6N3O2 — CID 102512842
1,1,1-trifluoro-4-[2-[2-[(5,5,5-trifluoro-4-oxopentan-2-ylidene)amino]ethylamino]ethylimino]pentan-2-one (PubChem CID 102512842) has the molecular formula C14H19F6N3O2 and a molecular weight of 375.31 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-[2-[2-[(5,5,5-trifluoro-4-oxopentan-2-ylidene)amino]ethylamino]ethylimino]pentan-2-one.
| Compound Name | 1,1,1-trifluoro-4-[2-[2-[(5,5,5-trifluoro-4-oxopentan-2-ylidene)amino]ethylamino]ethylimino]pentan-2-one |
|---|---|
| PubChem CID | 102512842 |
| Molecular Formula | C14H19F6N3O2 |
| Molecular Weight | 375.31 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 1,1,1-trifluoro-4-[2-[2-[(5,5,5-trifluoro-4-oxopentan-2-ylidene)amino]ethylamino]ethylimino]pentan-2-one |
| SMILES | C/C(CC(=O)C(F)(F)F)=N\CCNCC/N=C(\C)CC(=O)C(F)(F)F |
| InChI | InChI=1S/C14H19F6N3O2/c1-9(7-11(24)13(15,16)17)22-5-3-21-4-6-23-10(2)8-12(25)14(18,19)20/h21H,3-8H2,1-2H3/b22-9+,23-10+ |
| InChIKey | IHMFZAKMHYAMMH-HHAMRVRLSA-N |
| XLogP | 2.54 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|