C23H33NOS — CID 102512933
(2R,3S)-3-(dibenzylamino)-1-pentylsulfanylbutan-2-ol (PubChem CID 102512933) has the molecular formula C23H33NOS and a molecular weight of 371.59 g/mol. Its IUPAC name is (2R,3S)-3-(dibenzylamino)-1-pentylsulfanylbutan-2-ol.
| Compound Name | (2R,3S)-3-(dibenzylamino)-1-pentylsulfanylbutan-2-ol |
|---|---|
| PubChem CID | 102512933 |
| Molecular Formula | C23H33NOS |
| Molecular Weight | 371.59 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | (2R,3S)-3-(dibenzylamino)-1-pentylsulfanylbutan-2-ol |
| SMILES | CCCCCSC[C@H](O)[C@H](C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H33NOS/c1-3-4-11-16-26-19-23(25)20(2)24(17-21-12-7-5-8-13-21)18-22-14-9-6-10-15-22/h5-10,12-15,20,23,25H,3-4,11,16-19H2,1-2H3/t20-,23-/m0/s1 |
| InChIKey | MLXNUJGUZNBBNN-REWPJTCUSA-N |
| XLogP | 5.36 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.59 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|