C27H39NOS — CID 102512934
(2R,3S)-1-cyclohexylsulfanyl-3-(dibenzylamino)-5-methylhexan-2-ol (PubChem CID 102512934) has the molecular formula C27H39NOS and a molecular weight of 425.68 g/mol. Its IUPAC name is (2R,3S)-1-cyclohexylsulfanyl-3-(dibenzylamino)-5-methylhexan-2-ol.
| Compound Name | (2R,3S)-1-cyclohexylsulfanyl-3-(dibenzylamino)-5-methylhexan-2-ol |
|---|---|
| PubChem CID | 102512934 |
| Molecular Formula | C27H39NOS |
| Molecular Weight | 425.68 g/mol |
| Exact Mass | 425.28 |
| IUPAC Name | (2R,3S)-1-cyclohexylsulfanyl-3-(dibenzylamino)-5-methylhexan-2-ol |
| SMILES | CC(C)C[C@@H]([C@@H](O)CSC1CCCCC1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C27H39NOS/c1-22(2)18-26(27(29)21-30-25-16-10-5-11-17-25)28(19-23-12-6-3-7-13-23)20-24-14-8-4-9-15-24/h3-4,6-9,12-15,22,25-27,29H,5,10-11,16-21H2,1-2H3/t26-,27-/m0/s1 |
| InChIKey | RNCAITOMYMWBJC-SVBPBHIXSA-N |
| XLogP | 6.53 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.68 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |