C16H20O4 — CID 102513184
[(2R,8S,8aR)-5-acetyl-3,8-dimethyl-6-oxo-2,7,8,8a-tetrahydro-1H-naphthalen-2-yl] acetate (PubChem CID 102513184) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is [(2R,8S,8aR)-5-acetyl-3,8-dimethyl-6-oxo-2,7,8,8a-tetrahydro-1H-naphthalen-2-yl] acetate.
| Compound Name | [(2R,8S,8aR)-5-acetyl-3,8-dimethyl-6-oxo-2,7,8,8a-tetrahydro-1H-naphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 102513184 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | [(2R,8S,8aR)-5-acetyl-3,8-dimethyl-6-oxo-2,7,8,8a-tetrahydro-1H-naphthalen-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@H]2C(=C(C(C)=O)C(=O)C[C@@H]2C)C=C1C |
| InChI | InChI=1S/C16H20O4/c1-8-6-14(19)16(10(3)17)13-5-9(2)15(7-12(8)13)20-11(4)18/h5,8,12,15H,6-7H2,1-4H3/t8-,12+,15+/m0/s1 |
| InChIKey | ASWJAMHXDPXJPL-IBRIGMFSSA-N |
| XLogP | 2.38 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|