About 6-hydroxy-3-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]cyclohexa-2,4-dien-1-one
6-hydroxy-3-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]cyclohexa-2,4-dien-1-one (PubChem CID 102513461) has the molecular formula C18H20O3
and a molecular weight of 284.36 g/mol. Its IUPAC name is 6-hydroxy-3-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]cyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 6-hydroxy-3-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]cyclohexa-2,4-dien-1-one |
| PubChem CID | 102513461 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 6-hydroxy-3-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]cyclohexa-2,4-dien-1-one |
| SMILES | CC/C(C1=CC(=O)C(O)C=C1)=C(/CC)c1ccc(O)cc1 |
| InChI | InChI=1S/C18H20O3/c1-3-15(12-5-8-14(19)9-6-12)16(4-2)13-7-10-17(20)18(21)11-13/h5-11,17,19-20H,3-4H2,1-2H3/b16-15+ |
| InChIKey | OLJWJXNCOSABQZ-FOCLMDBBSA-N |
| XLogP | 3.39 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-hydroxy-3-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]cyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-3-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]cyclohexa-2,4-dien-1-one?
The IUPAC name of 6-hydroxy-3-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]cyclohexa-2,4-dien-1-one (CID 102513461) is 6-hydroxy-3-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]cyclohexa-2,4-dien-1-one.
What is the SMILES notation for 6-hydroxy-3-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]cyclohexa-2,4-dien-1-one?
The canonical SMILES for 6-hydroxy-3-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]cyclohexa-2,4-dien-1-one is CC/C(C1=CC(=O)C(O)C=C1)=C(/CC)c1ccc(O)cc1.
What is the InChIKey of 6-hydroxy-3-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]cyclohexa-2,4-dien-1-one?
The InChIKey is OLJWJXNCOSABQZ-FOCLMDBBSA-N. The full InChI is InChI=1S/C18H20O3/c1-3-15(12-5-8-14(19)9-6-12)16(4-2)13-7-10-17(20)18(21)11-13/h5-11,17,19-20H,3-4H2,1-2H3/b16-15+.
What are the key properties of 6-hydroxy-3-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]cyclohexa-2,4-dien-1-one?
6-hydroxy-3-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]cyclohexa-2,4-dien-1-one has a molecular weight of 284.36 g/mol, XLogP of 3.39, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-3-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]cyclohexa-2,4-dien-1-one is sourced from PubChem (CID 102513461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).