C18H20O4 — CID 102513729
(2-methyl-5-phenylmethoxycyclohexa-1,5-dien-1-yl) prop-2-enyl carbonate (PubChem CID 102513729) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is (2-methyl-5-phenylmethoxycyclohexa-1,5-dien-1-yl) prop-2-enyl carbonate.
| Compound Name | (2-methyl-5-phenylmethoxycyclohexa-1,5-dien-1-yl) prop-2-enyl carbonate |
|---|---|
| PubChem CID | 102513729 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (2-methyl-5-phenylmethoxycyclohexa-1,5-dien-1-yl) prop-2-enyl carbonate |
| SMILES | C=CCOC(=O)OC1=C(C)CCC(OCc2ccccc2)=C1 |
| InChI | InChI=1S/C18H20O4/c1-3-11-20-18(19)22-17-12-16(10-9-14(17)2)21-13-15-7-5-4-6-8-15/h3-8,12H,1,9-11,13H2,2H3 |
| InChIKey | UDBAQPXRJZSTMI-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|