C10H16O3 — CID 102514102
(1R)-1-[(2S,6R)-2-ethoxy-3,6-dihydro-2H-pyran-6-yl]prop-2-en-1-ol (PubChem CID 102514102) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is (1R)-1-[(2S,6R)-2-ethoxy-3,6-dihydro-2H-pyran-6-yl]prop-2-en-1-ol.
| Compound Name | (1R)-1-[(2S,6R)-2-ethoxy-3,6-dihydro-2H-pyran-6-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 102514102 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | (1R)-1-[(2S,6R)-2-ethoxy-3,6-dihydro-2H-pyran-6-yl]prop-2-en-1-ol |
| SMILES | C=C[C@@H](O)[C@H]1C=CC[C@@H](OCC)O1 |
| InChI | InChI=1S/C10H16O3/c1-3-8(11)9-6-5-7-10(13-9)12-4-2/h3,5-6,8-11H,1,4,7H2,2H3/t8-,9-,10+/m1/s1 |
| InChIKey | UCQWUFLTJRILLI-BBBLOLIVSA-N |
| XLogP | 1.24 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|