C8H14O4 — CID 2733895
1-(2,5-dimethoxy-2H-furan-5-yl)ethanol (PubChem CID 2733895) has the molecular formula C8H14O4 and a molecular weight of 174.20 g/mol. Its IUPAC name is 1-(2,5-dimethoxy-2H-furan-5-yl)ethanol.
| Compound Name | 1-(2,5-dimethoxy-2H-furan-5-yl)ethanol |
|---|---|
| PubChem CID | 2733895 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 1-(2,5-dimethoxy-2H-furan-5-yl)ethanol |
| SMILES | COC1C=CC(OC)(C(C)O)O1 |
| InChI | InChI=1S/C8H14O4/c1-6(9)8(11-3)5-4-7(10-2)12-8/h4-7,9H,1-3H3 |
| InChIKey | OHXZDCYIALCSNL-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|