C9H16O5 — CID 20348360
2-(1-Hydroxyethyl)-2,3,5-trimethoxy-2,5-dihydrofuran (PubChem CID 20348360) has the molecular formula C9H16O5 and a molecular weight of 204.22 g/mol. Its IUPAC name is 1-(2,4,5-trimethoxy-2H-furan-5-yl)ethanol.
| Compound Name | 2-(1-Hydroxyethyl)-2,3,5-trimethoxy-2,5-dihydrofuran |
|---|---|
| PubChem CID | 20348360 |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 1-(2,4,5-trimethoxy-2H-furan-5-yl)ethanol |
| SMILES | CC(C1(C(=CC(O1)OC)OC)OC)O |
| InChI | InChI=1S/C9H16O5/c1-6(10)9(13-4)7(11-2)5-8(12-3)14-9/h5-6,8,10H,1-4H3 |
| InChIKey | NDPORQIUDGZDFC-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 57.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | 227 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'} |
|---|