C28H32N2O3 — CID 102514174
5,5-dibenzyl-6-(benzylamino)-2-methyl-2-nitrohexan-3-one (PubChem CID 102514174) has the molecular formula C28H32N2O3 and a molecular weight of 444.58 g/mol. Its IUPAC name is 5,5-dibenzyl-6-(benzylamino)-2-methyl-2-nitrohexan-3-one.
| Compound Name | 5,5-dibenzyl-6-(benzylamino)-2-methyl-2-nitrohexan-3-one |
|---|---|
| PubChem CID | 102514174 |
| Molecular Formula | C28H32N2O3 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | 5,5-dibenzyl-6-(benzylamino)-2-methyl-2-nitrohexan-3-one |
| SMILES | CC(C)(C(=O)CC(CNCc1ccccc1)(Cc1ccccc1)Cc1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C28H32N2O3/c1-27(2,30(32)33)26(31)20-28(18-23-12-6-3-7-13-23,19-24-14-8-4-9-15-24)22-29-21-25-16-10-5-11-17-25/h3-17,29H,18-22H2,1-2H3 |
| InChIKey | UOQTXSICDKXCJF-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|