C15H25F3O4S2Si — CID 10251465
(4-methoxyphenyl)methyl-methyl-(1-trimethylsilylethyl)sulfanium;trifluoromethanesulfonate (PubChem CID 10251465) has the molecular formula C15H25F3O4S2Si and a molecular weight of 418.58 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl-methyl-(1-trimethylsilylethyl)sulfanium;trifluoromethanesulfonate.
| Compound Name | (4-methoxyphenyl)methyl-methyl-(1-trimethylsilylethyl)sulfanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10251465 |
| Molecular Formula | C15H25F3O4S2Si |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | (4-methoxyphenyl)methyl-methyl-(1-trimethylsilylethyl)sulfanium;trifluoromethanesulfonate |
| SMILES | COc1ccc(C[S+](C)C(C)[Si](C)(C)C)cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C14H25OSSi.CHF3O3S/c1-12(17(4,5)6)16(3)11-13-7-9-14(15-2)10-8-13;2-1(3,4)8(5,6)7/h7-10,12H,11H2,1-6H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | LPWBWQRTDGYSAA-UHFFFAOYSA-M |
| XLogP | 3.76 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|