C21H25F3N2O5S2Si — CID 11800463
[4,5-bis(4-methoxyphenyl)thiadiazol-3-ium-3-yl]methyl-trimethylsilane;trifluoromethanesulfonate (PubChem CID 11800463) has the molecular formula C21H25F3N2O5S2Si and a molecular weight of 534.65 g/mol. Its IUPAC name is [4,5-bis(4-methoxyphenyl)thiadiazol-3-ium-3-yl]methyl-trimethylsilane;trifluoromethanesulfonate.
| Compound Name | [4,5-bis(4-methoxyphenyl)thiadiazol-3-ium-3-yl]methyl-trimethylsilane;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11800463 |
| Molecular Formula | C21H25F3N2O5S2Si |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.09 |
| IUPAC Name | [4,5-bis(4-methoxyphenyl)thiadiazol-3-ium-3-yl]methyl-trimethylsilane;trifluoromethanesulfonate |
| SMILES | COc1ccc(-c2sn[n+](C[Si](C)(C)C)c2-c2ccc(OC)cc2)cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C20H25N2O2SSi.CHF3O3S/c1-23-17-10-6-15(7-11-17)19-20(16-8-12-18(24-2)13-9-16)25-21-22(19)14-26(3,4)5;2-1(3,4)8(5,6)7/h6-13H,14H2,1-5H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | WILDBDLFPYDFFF-UHFFFAOYSA-M |
| XLogP | 4.71 |
| TPSA | 92.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|