C6H2Cl3O4- — CID 102514978
2-chloro-2-(2,4-dichloro-5-oxofuran-2-yl)acetate (PubChem CID 102514978) has the molecular formula C6H2Cl3O4- and a molecular weight of 244.44 g/mol. Its IUPAC name is 2-chloro-2-(2,4-dichloro-5-oxofuran-2-yl)acetate.
| Compound Name | 2-chloro-2-(2,4-dichloro-5-oxofuran-2-yl)acetate |
|---|---|
| PubChem CID | 102514978 |
| Molecular Formula | C6H2Cl3O4- |
| Molecular Weight | 244.44 g/mol |
| Exact Mass | 242.90 |
| IUPAC Name | 2-chloro-2-(2,4-dichloro-5-oxofuran-2-yl)acetate |
| SMILES | O=C1OC(Cl)(C(Cl)C(=O)[O-])C=C1Cl |
| InChI | InChI=1S/C6H3Cl3O4/c7-2-1-6(9,13-5(2)12)3(8)4(10)11/h1,3H,(H,10,11)/p-1 |
| InChIKey | SLIIQDRTGIAUJS-UHFFFAOYSA-M |
| XLogP | -0.04 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.44 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|