C7H5Cl2O4- — CID 102515041
2-(2,4-dichloro-5-oxofuran-2-yl)propanoate (PubChem CID 102515041) has the molecular formula C7H5Cl2O4- and a molecular weight of 224.02 g/mol. Its IUPAC name is 2-(2,4-dichloro-5-oxofuran-2-yl)propanoate.
| Compound Name | 2-(2,4-dichloro-5-oxofuran-2-yl)propanoate |
|---|---|
| PubChem CID | 102515041 |
| Molecular Formula | C7H5Cl2O4- |
| Molecular Weight | 224.02 g/mol |
| Exact Mass | 222.96 |
| IUPAC Name | 2-(2,4-dichloro-5-oxofuran-2-yl)propanoate |
| SMILES | CC(C(=O)[O-])C1(Cl)C=C(Cl)C(=O)O1 |
| InChI | InChI=1S/C7H6Cl2O4/c1-3(5(10)11)7(9)2-4(8)6(12)13-7/h2-3H,1H3,(H,10,11)/p-1 |
| InChIKey | BPZDQHNUFMZFMW-UHFFFAOYSA-M |
| XLogP | -0.01 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.02 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|