C7H6Cl2O4 — CID 102515042
2-(2,4-dichloro-5-oxofuran-2-yl)propanoic acid (PubChem CID 102515042) has the molecular formula C7H6Cl2O4 and a molecular weight of 225.03 g/mol. Its IUPAC name is 2-(2,4-dichloro-5-oxofuran-2-yl)propanoic acid.
| Compound Name | 2-(2,4-dichloro-5-oxofuran-2-yl)propanoic acid |
|---|---|
| PubChem CID | 102515042 |
| Molecular Formula | C7H6Cl2O4 |
| Molecular Weight | 225.03 g/mol |
| Exact Mass | 223.96 |
| IUPAC Name | 2-(2,4-dichloro-5-oxofuran-2-yl)propanoic acid |
| SMILES | CC(C(=O)O)C1(Cl)C=C(Cl)C(=O)O1 |
| InChI | InChI=1S/C7H6Cl2O4/c1-3(5(10)11)7(9)2-4(8)6(12)13-7/h2-3H,1H3,(H,10,11) |
| InChIKey | BPZDQHNUFMZFMW-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.03 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|