2-(2,4-dichloro-5-oxofuran-2-yl)propanoic acid

C7H6Cl2O4 — CID 102515042

IUPAC2-(2,4-dichloro-5-oxofuran-2-yl)propanoic acid
SMILESCC(C(=O)O)C1(Cl)C=C(Cl)C(=O)O1
InChIInChI=1S/C7H6Cl2O4/c1-3(5(10)11)7(9)2-4(8)6(12)13-7/h2-3H,1H3,(H,10,11)
InChIKeyBPZDQHNUFMZFMW-UHFFFAOYSA-N
MW225.03 g/mol
LogP1.32
Rot. Bonds2

About 2-(2,4-dichloro-5-oxofuran-2-yl)propanoic acid

2-(2,4-dichloro-5-oxofuran-2-yl)propanoic acid (PubChem CID 102515042) has the molecular formula C7H6Cl2O4 and a molecular weight of 225.03 g/mol. Its IUPAC name is 2-(2,4-dichloro-5-oxofuran-2-yl)propanoic acid.

Molecular Properties

Compound Name2-(2,4-dichloro-5-oxofuran-2-yl)propanoic acid
PubChem CID102515042
Molecular FormulaC7H6Cl2O4
Molecular Weight225.03 g/mol
Exact Mass223.96
IUPAC Name2-(2,4-dichloro-5-oxofuran-2-yl)propanoic acid
SMILESCC(C(=O)O)C1(Cl)C=C(Cl)C(=O)O1
InChIInChI=1S/C7H6Cl2O4/c1-3(5(10)11)7(9)2-4(8)6(12)13-7/h2-3H,1H3,(H,10,11)
InChIKeyBPZDQHNUFMZFMW-UHFFFAOYSA-N
XLogP1.32
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.03
LogP ≤ 51.32
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 2-(2,4-dichloro-5-oxofuran-2-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,4-dichloro-5-oxofuran-2-yl)propanoic acid?
The IUPAC name of 2-(2,4-dichloro-5-oxofuran-2-yl)propanoic acid (CID 102515042) is 2-(2,4-dichloro-5-oxofuran-2-yl)propanoic acid.
What is the SMILES notation for 2-(2,4-dichloro-5-oxofuran-2-yl)propanoic acid?
The canonical SMILES for 2-(2,4-dichloro-5-oxofuran-2-yl)propanoic acid is CC(C(=O)O)C1(Cl)C=C(Cl)C(=O)O1.
What is the InChIKey of 2-(2,4-dichloro-5-oxofuran-2-yl)propanoic acid?
The InChIKey is BPZDQHNUFMZFMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6Cl2O4/c1-3(5(10)11)7(9)2-4(8)6(12)13-7/h2-3H,1H3,(H,10,11).
What are the key properties of 2-(2,4-dichloro-5-oxofuran-2-yl)propanoic acid?
2-(2,4-dichloro-5-oxofuran-2-yl)propanoic acid has a molecular weight of 225.03 g/mol, XLogP of 1.32, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dichloro-5-oxofuran-2-yl)propanoic acid is sourced from PubChem (CID 102515042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).