C17H20O4 — CID 102515850
methyl 3-[(1S,2S,7S,8R)-2,5-dimethyl-3,6-dioxo-1-tricyclo[6.2.1.02,7]undeca-4,9-dienyl]propanoate (PubChem CID 102515850) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is methyl 3-[(1S,2S,7S,8R)-2,5-dimethyl-3,6-dioxo-1-tricyclo[6.2.1.02,7]undeca-4,9-dienyl]propanoate.
| Compound Name | methyl 3-[(1S,2S,7S,8R)-2,5-dimethyl-3,6-dioxo-1-tricyclo[6.2.1.02,7]undeca-4,9-dienyl]propanoate |
|---|---|
| PubChem CID | 102515850 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | methyl 3-[(1S,2S,7S,8R)-2,5-dimethyl-3,6-dioxo-1-tricyclo[6.2.1.02,7]undeca-4,9-dienyl]propanoate |
| SMILES | COC(=O)CC[C@@]12C=C[C@@H](C1)[C@@H]1C(=O)C(C)=CC(=O)[C@@]12C |
| InChI | InChI=1S/C17H20O4/c1-10-8-12(18)16(2)14(15(10)20)11-4-6-17(16,9-11)7-5-13(19)21-3/h4,6,8,11,14H,5,7,9H2,1-3H3/t11-,14+,16-,17-/m0/s1 |
| InChIKey | MEGFAWGFJRCPEY-ISGYEWALSA-N |
| XLogP | 2.24 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|