C27H22F6O4 — CID 102517668
2-[[4-[2,2,2-trifluoro-1-[4-(oxiran-2-ylmethoxy)phenyl]-1-[3-(trifluoromethyl)phenyl]ethyl]phenoxy]methyl]oxirane (PubChem CID 102517668) has the molecular formula C27H22F6O4 and a molecular weight of 524.46 g/mol. Its IUPAC name is 2-[[4-[2,2,2-trifluoro-1-[4-(oxiran-2-ylmethoxy)phenyl]-1-[3-(trifluoromethyl)phenyl]ethyl]phenoxy]methyl]oxirane.
| Compound Name | 2-[[4-[2,2,2-trifluoro-1-[4-(oxiran-2-ylmethoxy)phenyl]-1-[3-(trifluoromethyl)phenyl]ethyl]phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 102517668 |
| Molecular Formula | C27H22F6O4 |
| Molecular Weight | 524.46 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | 2-[[4-[2,2,2-trifluoro-1-[4-(oxiran-2-ylmethoxy)phenyl]-1-[3-(trifluoromethyl)phenyl]ethyl]phenoxy]methyl]oxirane |
| SMILES | FC(F)(F)c1cccc(C(c2ccc(OCC3CO3)cc2)(c2ccc(OCC3CO3)cc2)C(F)(F)F)c1 |
| InChI | InChI=1S/C27H22F6O4/c28-26(29,30)20-3-1-2-19(12-20)25(27(31,32)33,17-4-8-21(9-5-17)34-13-23-15-36-23)18-6-10-22(11-7-18)35-14-24-16-37-24/h1-12,23-24H,13-16H2 |
| InChIKey | LKHZMYFUCFMMQU-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.46 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|