C63H84O9 — CID 102518176
5,6,15,16,24,25-hexahexoxyheptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1(20),2(10),3,5,7,11(19),12(17),13,15,21(26),22,24-dodecaene-9,18,27-trione (PubChem CID 102518176) has the molecular formula C63H84O9 and a molecular weight of 985.36 g/mol. Its IUPAC name is 5,6,15,16,24,25-hexahexoxyheptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1(20),2(10),3,5,7,11(19),12(17),13,15,21(26),22,24-dodecaene-9,18,27-trione.
| Compound Name | 5,6,15,16,24,25-hexahexoxyheptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1(20),2(10),3,5,7,11(19),12(17),13,15,21(26),22,24-dodecaene-9,18,27-trione |
|---|---|
| PubChem CID | 102518176 |
| Molecular Formula | C63H84O9 |
| Molecular Weight | 985.36 g/mol |
| Exact Mass | 984.61 |
| IUPAC Name | 5,6,15,16,24,25-hexahexoxyheptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1(20),2(10),3,5,7,11(19),12(17),13,15,21(26),22,24-dodecaene-9,18,27-trione |
| SMILES | CCCCCCOc1cc2c(=O)c3c(c2cc1OCCCCCC)c1c(=O)c2c(OCCCCCC)c(OCCCCCC)ccc2c1c1c(=O)c2c(OCCCCCC)c(OCCCCCC)ccc2c31 |
| InChI | InChI=1S/C63H84O9/c1-7-13-19-25-35-67-47-33-31-43-51-56-53(45-41-49(69-37-27-21-15-9-3)50(42-46(45)59(56)64)70-38-28-22-16-10-4)58-52(57(51)60(65)54(43)62(47)71-39-29-23-17-11-5)44-32-34-48(68-36-26-20-14-8-2)63(55(44)61(58)66)72-40-30-24-18-12-6/h31-34,41-42H,7-30,35-40H2,1-6H3 |
| InChIKey | KNAMZJSMXRZJLX-UHFFFAOYSA-N |
| XLogP | 16.75 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 985.36 |
| LogP ≤ 5 | 16.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|