C51H77N3O6 — CID 132942746
1-(3-azidopropoxy)-2,6,7,10,11-pentahexoxytriphenylene (PubChem CID 132942746) has the molecular formula C51H77N3O6 and a molecular weight of 828.19 g/mol. Its IUPAC name is 1-(3-azidopropoxy)-2,6,7,10,11-pentahexoxytriphenylene.
| Compound Name | 1-(3-azidopropoxy)-2,6,7,10,11-pentahexoxytriphenylene |
|---|---|
| PubChem CID | 132942746 |
| Molecular Formula | C51H77N3O6 |
| Molecular Weight | 828.19 g/mol |
| Exact Mass | 827.58 |
| IUPAC Name | 1-(3-azidopropoxy)-2,6,7,10,11-pentahexoxytriphenylene |
| SMILES | CCCCCCOc1cc2c(cc1OCCCCCC)c1ccc(OCCCCCC)c(OCCCN=[N+]=[N-])c1c1cc(OCCCCCC)c(OCCCCCC)cc21 |
| InChI | InChI=1S/C51H77N3O6/c1-6-11-16-21-30-55-45-28-27-40-41-36-46(56-31-22-17-12-7-2)47(57-32-23-18-13-8-3)37-42(41)43-38-48(58-33-24-19-14-9-4)49(59-34-25-20-15-10-5)39-44(43)50(40)51(45)60-35-26-29-53-54-52/h27-28,36-39H,6-26,29-35H2,1-5H3 |
| InChIKey | NPYIZEPVKSRYAY-UHFFFAOYSA-N |
| XLogP | 16.02 |
| TPSA | 104.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.19 |
| LogP ≤ 5 | 16.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|