C29H27F3NO3P — CID 102518499
N-benzyl-1-bis(phenylmethoxy)phosphoryl-1-[4-(trifluoromethyl)phenyl]methanamine (PubChem CID 102518499) has the molecular formula C29H27F3NO3P and a molecular weight of 525.51 g/mol. Its IUPAC name is N-benzyl-1-bis(phenylmethoxy)phosphoryl-1-[4-(trifluoromethyl)phenyl]methanamine.
| Compound Name | N-benzyl-1-bis(phenylmethoxy)phosphoryl-1-[4-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 102518499 |
| Molecular Formula | C29H27F3NO3P |
| Molecular Weight | 525.51 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | N-benzyl-1-bis(phenylmethoxy)phosphoryl-1-[4-(trifluoromethyl)phenyl]methanamine |
| SMILES | O=P(OCc1ccccc1)(OCc1ccccc1)C(NCc1ccccc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C29H27F3NO3P/c30-29(31,32)27-18-16-26(17-19-27)28(33-20-23-10-4-1-5-11-23)37(34,35-21-24-12-6-2-7-13-24)36-22-25-14-8-3-9-15-25/h1-19,28,33H,20-22H2 |
| InChIKey | IQIWAQXAXYTXLF-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.51 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|