C13H18O5 — CID 102521359
ethyl (2Z)-2-[(3aS,6R,6aS)-6-ethenyl-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ylidene]acetate (PubChem CID 102521359) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is ethyl (2Z)-2-[(3aS,6R,6aS)-6-ethenyl-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ylidene]acetate.
| Compound Name | ethyl (2Z)-2-[(3aS,6R,6aS)-6-ethenyl-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ylidene]acetate |
|---|---|
| PubChem CID | 102521359 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | ethyl (2Z)-2-[(3aS,6R,6aS)-6-ethenyl-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-ylidene]acetate |
| SMILES | C=C[C@H]1O/C(=C\C(=O)OCC)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C13H18O5/c1-5-8-11-12(18-13(3,4)17-11)9(16-8)7-10(14)15-6-2/h5,7-8,11-12H,1,6H2,2-4H3/b9-7-/t8-,11+,12-/m1/s1 |
| InChIKey | KGLQWQNZDLGFLR-IEBNTKBUSA-N |
| XLogP | 1.54 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|