methyl (2Z)-2-(2,5-dipropyl-1,3-dioxolan-4-ylidene)acetate

C12H20O4 — CID 101153857

IUPACmethyl (2Z)-2-(2,5-dipropyl-1,3-dioxolan-4-ylidene)acetate
SMILESCCCC1O/C(=C\C(=O)OC)C(CCC)O1
InChIInChI=1S/C12H20O4/c1-4-6-9-10(8-11(13)14-3)16-12(15-9)7-5-2/h8-9,12H,4-7H2,1-3H3/b10-8-
InChIKeyNDXXOJPVNZBTGC-NTMALXAHSA-N
MW228.29 g/mol
LogP2.38
Rot. Bonds5

About methyl (2Z)-2-(2,5-dipropyl-1,3-dioxolan-4-ylidene)acetate

methyl (2Z)-2-(2,5-dipropyl-1,3-dioxolan-4-ylidene)acetate (PubChem CID 101153857) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is methyl (2Z)-2-(2,5-dipropyl-1,3-dioxolan-4-ylidene)acetate.

Molecular Properties

Compound Namemethyl (2Z)-2-(2,5-dipropyl-1,3-dioxolan-4-ylidene)acetate
PubChem CID101153857
Molecular FormulaC12H20O4
Molecular Weight228.29 g/mol
Exact Mass228.14
IUPAC Namemethyl (2Z)-2-(2,5-dipropyl-1,3-dioxolan-4-ylidene)acetate
SMILESCCCC1O/C(=C\C(=O)OC)C(CCC)O1
InChIInChI=1S/C12H20O4/c1-4-6-9-10(8-11(13)14-3)16-12(15-9)7-5-2/h8-9,12H,4-7H2,1-3H3/b10-8-
InChIKeyNDXXOJPVNZBTGC-NTMALXAHSA-N
XLogP2.38
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.29
LogP ≤ 52.38
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl (2Z)-2-(2,5-dipropyl-1,3-dioxolan-4-ylidene)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2Z)-2-(2,5-dipropyl-1,3-dioxolan-4-ylidene)acetate?
The IUPAC name of methyl (2Z)-2-(2,5-dipropyl-1,3-dioxolan-4-ylidene)acetate (CID 101153857) is methyl (2Z)-2-(2,5-dipropyl-1,3-dioxolan-4-ylidene)acetate.
What is the SMILES notation for methyl (2Z)-2-(2,5-dipropyl-1,3-dioxolan-4-ylidene)acetate?
The canonical SMILES for methyl (2Z)-2-(2,5-dipropyl-1,3-dioxolan-4-ylidene)acetate is CCCC1O/C(=C\C(=O)OC)C(CCC)O1.
What is the InChIKey of methyl (2Z)-2-(2,5-dipropyl-1,3-dioxolan-4-ylidene)acetate?
The InChIKey is NDXXOJPVNZBTGC-NTMALXAHSA-N. The full InChI is InChI=1S/C12H20O4/c1-4-6-9-10(8-11(13)14-3)16-12(15-9)7-5-2/h8-9,12H,4-7H2,1-3H3/b10-8-.
What are the key properties of methyl (2Z)-2-(2,5-dipropyl-1,3-dioxolan-4-ylidene)acetate?
methyl (2Z)-2-(2,5-dipropyl-1,3-dioxolan-4-ylidene)acetate has a molecular weight of 228.29 g/mol, XLogP of 2.38, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2Z)-2-(2,5-dipropyl-1,3-dioxolan-4-ylidene)acetate is sourced from PubChem (CID 101153857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).