C13H20O6 — CID 15297896
methyl (E)-3-[2-[(3S)-3-acetyloxybutyl]-1,3-dioxolan-2-yl]prop-2-enoate (PubChem CID 15297896) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is methyl (E)-3-[2-[(3S)-3-acetyloxybutyl]-1,3-dioxolan-2-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[2-[(3S)-3-acetyloxybutyl]-1,3-dioxolan-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 15297896 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | methyl (E)-3-[2-[(3S)-3-acetyloxybutyl]-1,3-dioxolan-2-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/C1(CC[C@H](C)OC(C)=O)OCCO1 |
| InChI | InChI=1S/C13H20O6/c1-10(19-11(2)14)4-6-13(17-8-9-18-13)7-5-12(15)16-3/h5,7,10H,4,6,8-9H2,1-3H3/b7-5+/t10-/m0/s1 |
| InChIKey | XISLHBJAPISZGR-STUBTGCMSA-N |
| XLogP | 1.19 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|