C34H50O9 — CID 102521558
[(2R,2'S,3'aR,4'R,7'aR)-2,2'-dioctyl-5-oxospiro[1,3-dioxolane-4,6'-4,5,7,7a-tetrahydro-3aH-1,3-benzodioxole]-4'-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 102521558) has the molecular formula C34H50O9 and a molecular weight of 602.77 g/mol. Its IUPAC name is [(2R,2'S,3'aR,4'R,7'aR)-2,2'-dioctyl-5-oxospiro[1,3-dioxolane-4,6'-4,5,7,7a-tetrahydro-3aH-1,3-benzodioxole]-4'-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [(2R,2'S,3'aR,4'R,7'aR)-2,2'-dioctyl-5-oxospiro[1,3-dioxolane-4,6'-4,5,7,7a-tetrahydro-3aH-1,3-benzodioxole]-4'-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 102521558 |
| Molecular Formula | C34H50O9 |
| Molecular Weight | 602.77 g/mol |
| Exact Mass | 602.35 |
| IUPAC Name | [(2R,2'S,3'aR,4'R,7'aR)-2,2'-dioctyl-5-oxospiro[1,3-dioxolane-4,6'-4,5,7,7a-tetrahydro-3aH-1,3-benzodioxole]-4'-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | CCCCCCCC[C@@H]1O[C@H]2[C@H](OC(=O)/C=C/c3ccc(O)c(O)c3)CC3(C[C@H]2O1)O[C@@H](CCCCCCCC)OC3=O |
| InChI | InChI=1S/C34H50O9/c1-3-5-7-9-11-13-15-30-40-28-23-34(33(38)42-31(43-34)16-14-12-10-8-6-4-2)22-27(32(28)41-30)39-29(37)20-18-24-17-19-25(35)26(36)21-24/h17-21,27-28,30-32,35-36H,3-16,22-23H2,1-2H3/b20-18+/t27-,28-,30+,31+,32+,34?/m1/s1 |
| InChIKey | OMKHWFMCUXHSFW-WBIPXFSQSA-N |
| XLogP | 7.07 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.77 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|