C19H22O9 — CID 46230345
[(2R,5R,7R,8S,9R)-2-ethyl-8,9-dihydroxy-4-oxo-1,3-dioxaspiro[4.5]decan-7-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 46230345) has the molecular formula C19H22O9 and a molecular weight of 394.38 g/mol. Its IUPAC name is [(2R,5R,7R,8S,9R)-2-ethyl-8,9-dihydroxy-4-oxo-1,3-dioxaspiro[4.5]decan-7-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [(2R,5R,7R,8S,9R)-2-ethyl-8,9-dihydroxy-4-oxo-1,3-dioxaspiro[4.5]decan-7-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 46230345 |
| Molecular Formula | C19H22O9 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | [(2R,5R,7R,8S,9R)-2-ethyl-8,9-dihydroxy-4-oxo-1,3-dioxaspiro[4.5]decan-7-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | CC[C@H]1OC(=O)[C@]2(C[C@@H](O)[C@H](O)[C@H](OC(=O)/C=C/c3ccc(O)c(O)c3)C2)O1 |
| InChI | InChI=1S/C19H22O9/c1-2-16-27-18(25)19(28-16)8-13(22)17(24)14(9-19)26-15(23)6-4-10-3-5-11(20)12(21)7-10/h3-7,13-14,16-17,20-22,24H,2,8-9H2,1H3/b6-4+/t13-,14-,16+,17+,19-/m1/s1 |
| InChIKey | IRYOWHDAPNQFSG-UURRWRLGSA-N |
| XLogP | 0.59 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|